C43H58O5 — CID 139709786
4-[7-(1-adamantyl)-3-(6-hydroxyoctoxy)-1-octoxynaphthalen-2-yl]benzoic acid (PubChem CID 139709786) has the molecular formula C43H58O5 and a molecular weight of 654.93 g/mol. Its IUPAC name is 4-[7-(1-adamantyl)-3-(6-hydroxyoctoxy)-1-octoxynaphthalen-2-yl]benzoic acid.
| Compound Name | 4-[7-(1-adamantyl)-3-(6-hydroxyoctoxy)-1-octoxynaphthalen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 139709786 |
| Molecular Formula | C43H58O5 |
| Molecular Weight | 654.93 g/mol |
| Exact Mass | 654.43 |
| IUPAC Name | 4-[7-(1-adamantyl)-3-(6-hydroxyoctoxy)-1-octoxynaphthalen-2-yl]benzoic acid |
| SMILES | CCCCCCCCOc1c(-c2ccc(C(=O)O)cc2)c(OCCCCCC(O)CC)cc2ccc(C34CC5CC(CC(C5)C3)C4)cc12 |
| InChI | InChI=1S/C43H58O5/c1-3-5-6-7-8-11-21-48-41-38-26-36(43-27-30-22-31(28-43)24-32(23-30)29-43)19-18-35(38)25-39(47-20-12-9-10-13-37(44)4-2)40(41)33-14-16-34(17-15-33)42(45)46/h14-19,25-26,30-32,37,44H,3-13,20-24,27-29H2,1-2H3,(H,45,46) |
| InChIKey | PFOIBGLUTHYMPS-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.93 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|