C35H42O4 — CID 67591078
2-[7-(1-adamantyl)naphthalen-2-yl]-3-(6-hydroxyoctoxy)benzoic acid (PubChem CID 67591078) has the molecular formula C35H42O4 and a molecular weight of 526.72 g/mol. Its IUPAC name is 2-[7-(1-adamantyl)naphthalen-2-yl]-3-(6-hydroxyoctoxy)benzoic acid.
| Compound Name | 2-[7-(1-adamantyl)naphthalen-2-yl]-3-(6-hydroxyoctoxy)benzoic acid |
|---|---|
| PubChem CID | 67591078 |
| Molecular Formula | C35H42O4 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 2-[7-(1-adamantyl)naphthalen-2-yl]-3-(6-hydroxyoctoxy)benzoic acid |
| SMILES | CCC(O)CCCCCOc1cccc(C(=O)O)c1-c1ccc2ccc(C34CC5CC(CC(C5)C3)C4)cc2c1 |
| InChI | InChI=1S/C35H42O4/c1-2-30(36)7-4-3-5-14-39-32-9-6-8-31(34(37)38)33(32)27-11-10-26-12-13-29(19-28(26)18-27)35-20-23-15-24(21-35)17-25(16-23)22-35/h6,8-13,18-19,23-25,30,36H,2-5,7,14-17,20-22H2,1H3,(H,37,38) |
| InChIKey | QVJCDDXGBKCIPZ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|