C35H40O5 — CID 67590611
2-[7-(1-adamantyl)-6-(6-ethoxy-6-oxohexoxy)naphthalen-2-yl]benzoic acid (PubChem CID 67590611) has the molecular formula C35H40O5 and a molecular weight of 540.70 g/mol. Its IUPAC name is 2-[7-(1-adamantyl)-6-(6-ethoxy-6-oxohexoxy)naphthalen-2-yl]benzoic acid.
| Compound Name | 2-[7-(1-adamantyl)-6-(6-ethoxy-6-oxohexoxy)naphthalen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 67590611 |
| Molecular Formula | C35H40O5 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 2-[7-(1-adamantyl)-6-(6-ethoxy-6-oxohexoxy)naphthalen-2-yl]benzoic acid |
| SMILES | CCOC(=O)CCCCCOc1cc2ccc(-c3ccccc3C(=O)O)cc2cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C35H40O5/c1-2-39-33(36)10-4-3-7-13-40-32-19-26-11-12-27(29-8-5-6-9-30(29)34(37)38)17-28(26)18-31(32)35-20-23-14-24(21-35)16-25(15-23)22-35/h5-6,8-9,11-12,17-19,23-25H,2-4,7,10,13-16,20-22H2,1H3,(H,37,38) |
| InChIKey | LMBHSXFOSGAGAS-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|