C36H46O5 — CID 175361370
ethyl 5-[3-(1-adamantyl)-4-[4-(2-methyl-2-prop-2-enoyloxypropyl)phenyl]phenoxy]pentanoate (PubChem CID 175361370) has the molecular formula C36H46O5 and a molecular weight of 558.76 g/mol. Its IUPAC name is ethyl 5-[3-(1-adamantyl)-4-[4-(2-methyl-2-prop-2-enoyloxypropyl)phenyl]phenoxy]pentanoate.
| Compound Name | ethyl 5-[3-(1-adamantyl)-4-[4-(2-methyl-2-prop-2-enoyloxypropyl)phenyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 175361370 |
| Molecular Formula | C36H46O5 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | ethyl 5-[3-(1-adamantyl)-4-[4-(2-methyl-2-prop-2-enoyloxypropyl)phenyl]phenoxy]pentanoate |
| SMILES | C=CC(=O)OC(C)(C)Cc1ccc(-c2ccc(OCCCCC(=O)OCC)cc2C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C36H46O5/c1-5-33(37)41-35(3,4)21-25-10-12-29(13-11-25)31-15-14-30(40-16-8-7-9-34(38)39-6-2)20-32(31)36-22-26-17-27(23-36)19-28(18-26)24-36/h5,10-15,20,26-28H,1,6-9,16-19,21-24H2,2-4H3 |
| InChIKey | IGDHXDFWVBVSGD-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|