C33H41NO5 — CID 175361384
2-[4-[2-(1-adamantyl)-4-[8-(hydroxyamino)-8-oxooctoxy]phenyl]phenyl]prop-2-enoic acid (PubChem CID 175361384) has the molecular formula C33H41NO5 and a molecular weight of 531.69 g/mol. Its IUPAC name is 2-[4-[2-(1-adamantyl)-4-[8-(hydroxyamino)-8-oxooctoxy]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | 2-[4-[2-(1-adamantyl)-4-[8-(hydroxyamino)-8-oxooctoxy]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175361384 |
| Molecular Formula | C33H41NO5 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | 2-[4-[2-(1-adamantyl)-4-[8-(hydroxyamino)-8-oxooctoxy]phenyl]phenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccc(-c2ccc(OCCCCCCCC(=O)NO)cc2C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C33H41NO5/c1-22(32(36)37)26-8-10-27(11-9-26)29-13-12-28(39-14-6-4-2-3-5-7-31(35)34-38)18-30(29)33-19-23-15-24(20-33)17-25(16-23)21-33/h8-13,18,23-25,38H,1-7,14-17,19-21H2,(H,34,35)(H,36,37) |
| InChIKey | VRSJGVFMNZIVEF-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|