About 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide
7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide (PubChem CID 142086769) has the molecular formula C19H21NO3
and a molecular weight of 311.38 g/mol. Its IUPAC name is 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide.
Molecular Properties
| Compound Name | 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide |
| PubChem CID | 142086769 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCOc1ccc(-c2cc#ccc2)cc1)NO |
| InChI | InChI=1S/C19H21NO3/c21-19(20-22)10-6-1-2-7-15-23-18-13-11-17(12-14-18)16-8-4-3-5-9-16/h4,8-9,11-14,22H,1-2,6-7,10,15H2,(H,20,21) |
| InChIKey | RLPMSVSFFKLIFV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide?
The IUPAC name of 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide (CID 142086769) is 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide.
What is the SMILES notation for 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide?
The canonical SMILES for 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide is O=C(CCCCCCOc1ccc(-c2cc#ccc2)cc1)NO.
What is the InChIKey of 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide?
The InChIKey is RLPMSVSFFKLIFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3/c21-19(20-22)10-6-1-2-7-15-23-18-13-11-17(12-14-18)16-8-4-3-5-9-16/h4,8-9,11-14,22H,1-2,6-7,10,15H2,(H,20,21).
What are the key properties of 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide?
7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide has a molecular weight of 311.38 g/mol, XLogP of 3.79, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-cyclohexa-1,5-dien-3-yn-1-ylphenoxy)-N-hydroxyheptanamide is sourced from PubChem (CID 142086769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).