C35H40O5 — CID 22376848
[7-(1-adamantyl)-6-(6-ethoxy-6-oxohexoxy)naphthalen-2-yl] benzoate (PubChem CID 22376848) has the molecular formula C35H40O5 and a molecular weight of 540.70 g/mol. Its IUPAC name is [7-(1-adamantyl)-6-(6-ethoxy-6-oxohexoxy)naphthalen-2-yl] benzoate.
| Compound Name | [7-(1-adamantyl)-6-(6-ethoxy-6-oxohexoxy)naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 22376848 |
| Molecular Formula | C35H40O5 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | [7-(1-adamantyl)-6-(6-ethoxy-6-oxohexoxy)naphthalen-2-yl] benzoate |
| SMILES | CCOC(=O)CCCCCOc1cc2ccc(OC(=O)c3ccccc3)cc2cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C35H40O5/c1-2-38-33(36)11-7-4-8-14-39-32-20-28-12-13-30(40-34(37)27-9-5-3-6-10-27)18-29(28)19-31(32)35-21-24-15-25(22-35)17-26(16-24)23-35/h3,5-6,9-10,12-13,18-20,24-26H,2,4,7-8,11,14-17,21-23H2,1H3 |
| InChIKey | SNUASZWBURBUFB-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|