C19H18O4S — CID 19834242
2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)terephthalic acid (PubChem CID 19834242) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)terephthalic acid.
| Compound Name | 2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)terephthalic acid |
|---|---|
| PubChem CID | 19834242 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)terephthalic acid |
| SMILES | CC1(C)CCSc2ccc(-c3cc(C(=O)O)ccc3C(=O)O)cc21 |
| InChI | InChI=1S/C19H18O4S/c1-19(2)7-8-24-16-6-4-11(10-15(16)19)14-9-12(17(20)21)3-5-13(14)18(22)23/h3-6,9-10H,7-8H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | XZLMIJWKMFUWGL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |