About 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid
6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid (PubChem CID 91880678) has the molecular formula C12H13BrO2S
and a molecular weight of 301.21 g/mol. Its IUPAC name is 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid.
Analyze 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid?
The IUPAC name of 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid (CID 91880678) is 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid.
What is the SMILES notation for 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid?
The canonical SMILES for 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid is CC1(C)CCSc2cc(C(=O)O)c(Br)cc21.
What is the InChIKey of 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid?
The InChIKey is BVTKKEUSPGUMAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO2S/c1-12(2)3-4-16-10-5-7(11(14)15)9(13)6-8(10)12/h5-6H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid?
6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid has a molecular weight of 301.21 g/mol, XLogP of 3.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,4-dimethyl-2,3-dihydrothiochromene-7-carboxylic acid is sourced from PubChem (CID 91880678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).