C29H36Br2O — CID 22992387
bis(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanone (PubChem CID 22992387) has the molecular formula C29H36Br2O and a molecular weight of 560.41 g/mol. Its IUPAC name is bis(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanone.
| Compound Name | bis(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 22992387 |
| Molecular Formula | C29H36Br2O |
| Molecular Weight | 560.41 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | bis(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methanone |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)c3cc4c(cc3Br)C(C)(C)CCC4(C)C)c(Br)cc21 |
| InChI | InChI=1S/C29H36Br2O/c1-26(2)9-11-28(5,6)21-15-23(30)17(13-19(21)26)25(32)18-14-20-22(16-24(18)31)29(7,8)12-10-27(20,3)4/h13-16H,9-12H2,1-8H3 |
| InChIKey | VOMGZOXTAXYNQF-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.41 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |