C21H22O4S — CID 18990100
4-[(E)-2-(3-methyl-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-7-yl)prop-1-enyl]benzoic acid (PubChem CID 18990100) has the molecular formula C21H22O4S and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-[(E)-2-(3-methyl-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-7-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-2-(3-methyl-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-7-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 18990100 |
| Molecular Formula | C21H22O4S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-[(E)-2-(3-methyl-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-7-yl)prop-1-enyl]benzoic acid |
| SMILES | C/C(=C\c1ccc(C(=O)O)cc1)c1ccc2c(c1)CCC(C)CS2(=O)=O |
| InChI | InChI=1S/C21H22O4S/c1-14-3-6-19-12-18(9-10-20(19)26(24,25)13-14)15(2)11-16-4-7-17(8-5-16)21(22)23/h4-5,7-12,14H,3,6,13H2,1-2H3,(H,22,23)/b15-11+ |
| InChIKey | YHCNSOKBVIONKZ-RVDMUPIBSA-N |
| XLogP | 4.30 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|