C27H33NO2 — CID 70349283
(E)-N-ethyl-2-methyl-3-[4-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)phenyl]prop-2-enamide (PubChem CID 70349283) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is (E)-N-ethyl-2-methyl-3-[4-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-ethyl-2-methyl-3-[4-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70349283 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (E)-N-ethyl-2-methyl-3-[4-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)phenyl]prop-2-enamide |
| SMILES | CCNC(=O)/C(C)=C/c1ccc(C(=O)c2ccc3c(c2)C(C)(C)C(C)C3(C)C)cc1 |
| InChI | InChI=1S/C27H33NO2/c1-8-28-25(30)17(2)15-19-9-11-20(12-10-19)24(29)21-13-14-22-23(16-21)27(6,7)18(3)26(22,4)5/h9-16,18H,8H2,1-7H3,(H,28,30)/b17-15+ |
| InChIKey | CFRXGSCAGOBILA-BMRADRMJSA-N |
| XLogP | 5.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|