C20H28O3 — CID 19774796
ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate (PubChem CID 19774796) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate.
| Compound Name | ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate |
|---|---|
| PubChem CID | 19774796 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate |
| SMILES | CCOC(=O)CCC(=O)c1ccc2c(c1)C(C)(C)C(C)C2(C)C |
| InChI | InChI=1S/C20H28O3/c1-7-23-18(22)11-10-17(21)14-8-9-15-16(12-14)20(5,6)13(2)19(15,3)4/h8-9,12-13H,7,10-11H2,1-6H3 |
| InChIKey | YNDVKSZMHPSQQA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |