ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate

C20H28O3 — CID 19774796

IUPACethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate
SMILESCCOC(=O)CCC(=O)c1ccc2c(c1)C(C)(C)C(C)C2(C)C
InChIInChI=1S/C20H28O3/c1-7-23-18(22)11-10-17(21)14-8-9-15-16(12-14)20(5,6)13(2)19(15,3)4/h8-9,12-13H,7,10-11H2,1-6H3
InChIKeyYNDVKSZMHPSQQA-UHFFFAOYSA-N
MW316.44 g/mol
LogP4.42
Rot. Bonds5

About ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate

ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate (PubChem CID 19774796) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate.

Molecular Properties

Compound Nameethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate
PubChem CID19774796
Molecular FormulaC20H28O3
Molecular Weight316.44 g/mol
Exact Mass316.20
IUPAC Nameethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate
SMILESCCOC(=O)CCC(=O)c1ccc2c(c1)C(C)(C)C(C)C2(C)C
InChIInChI=1S/C20H28O3/c1-7-23-18(22)11-10-17(21)14-8-9-15-16(12-14)20(5,6)13(2)19(15,3)4/h8-9,12-13H,7,10-11H2,1-6H3
InChIKeyYNDVKSZMHPSQQA-UHFFFAOYSA-N
XLogP4.42
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.44
LogP ≤ 54.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate?
The IUPAC name of ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate (CID 19774796) is ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate.
What is the SMILES notation for ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate?
The canonical SMILES for ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate is CCOC(=O)CCC(=O)c1ccc2c(c1)C(C)(C)C(C)C2(C)C.
What is the InChIKey of ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate?
The InChIKey is YNDVKSZMHPSQQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O3/c1-7-23-18(22)11-10-17(21)14-8-9-15-16(12-14)20(5,6)13(2)19(15,3)4/h8-9,12-13H,7,10-11H2,1-6H3.
What are the key properties of ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate?
ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate has a molecular weight of 316.44 g/mol, XLogP of 4.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxo-4-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)butanoate is sourced from PubChem (CID 19774796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).