C16H22BrNO4 — CID 123826611
ethyl 7-(4-bromophenyl)-4,7-dioxoheptanoate;methanamine (PubChem CID 123826611) has the molecular formula C16H22BrNO4 and a molecular weight of 372.26 g/mol. Its IUPAC name is ethyl 7-(4-bromophenyl)-4,7-dioxoheptanoate;methanamine.
| Compound Name | ethyl 7-(4-bromophenyl)-4,7-dioxoheptanoate;methanamine |
|---|---|
| PubChem CID | 123826611 |
| Molecular Formula | C16H22BrNO4 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | ethyl 7-(4-bromophenyl)-4,7-dioxoheptanoate;methanamine |
| SMILES | CCOC(=O)CCC(=O)CCC(=O)c1ccc(Br)cc1.CN |
| InChI | InChI=1S/C15H17BrO4.CH5N/c1-2-20-15(19)10-8-13(17)7-9-14(18)11-3-5-12(16)6-4-11;1-2/h3-6H,2,7-10H2,1H3;2H2,1H3 |
| InChIKey | WSQKCYBUCIRTOK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |