C19H17BrO4S — CID 55306375
[2-(4-methylsulfanylphenyl)-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate (PubChem CID 55306375) has the molecular formula C19H17BrO4S and a molecular weight of 421.31 g/mol. Its IUPAC name is [2-(4-methylsulfanylphenyl)-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate.
| Compound Name | [2-(4-methylsulfanylphenyl)-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 55306375 |
| Molecular Formula | C19H17BrO4S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | [2-(4-methylsulfanylphenyl)-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate |
| SMILES | CSc1ccc(C(=O)COC(=O)CCC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H17BrO4S/c1-25-16-8-4-14(5-9-16)18(22)12-24-19(23)11-10-17(21)13-2-6-15(20)7-3-13/h2-9H,10-12H2,1H3 |
| InChIKey | OGFGRZPKVZJYLD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |