C24H20BrNO4S — CID 4226196
[2-(4-bromophenyl)-2-oxoethyl] 4-oxo-4-(4-phenylsulfanylanilino)butanoate (PubChem CID 4226196) has the molecular formula C24H20BrNO4S and a molecular weight of 498.40 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 4-oxo-4-(4-phenylsulfanylanilino)butanoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 4-oxo-4-(4-phenylsulfanylanilino)butanoate |
|---|---|
| PubChem CID | 4226196 |
| Molecular Formula | C24H20BrNO4S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 4-oxo-4-(4-phenylsulfanylanilino)butanoate |
| SMILES | O=C(CCC(=O)OCC(=O)c1ccc(Br)cc1)Nc1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C24H20BrNO4S/c25-18-8-6-17(7-9-18)22(27)16-30-24(29)15-14-23(28)26-19-10-12-21(13-11-19)31-20-4-2-1-3-5-20/h1-13H,14-16H2,(H,26,28) |
| InChIKey | PHNPVJCTTYTPAG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |