C26H25NO4S — CID 3638806
[2-(4-methylphenyl)-2-oxoethyl] 5-oxo-5-(4-phenylsulfanylanilino)pentanoate (PubChem CID 3638806) has the molecular formula C26H25NO4S and a molecular weight of 447.56 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-5-(4-phenylsulfanylanilino)pentanoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-5-(4-phenylsulfanylanilino)pentanoate |
|---|---|
| PubChem CID | 3638806 |
| Molecular Formula | C26H25NO4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 5-oxo-5-(4-phenylsulfanylanilino)pentanoate |
| SMILES | Cc1ccc(C(=O)COC(=O)CCCC(=O)Nc2ccc(Sc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H25NO4S/c1-19-10-12-20(13-11-19)24(28)18-31-26(30)9-5-8-25(29)27-21-14-16-23(17-15-21)32-22-6-3-2-4-7-22/h2-4,6-7,10-17H,5,8-9,18H2,1H3,(H,27,29) |
| InChIKey | OGFVYPPYZJCTJC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |