C25H22N2O6S — CID 5239702
[2-(3-nitrophenyl)-2-oxoethyl] 4-[4-(4-methylphenyl)sulfanylanilino]-4-oxobutanoate (PubChem CID 5239702) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 4-[4-(4-methylphenyl)sulfanylanilino]-4-oxobutanoate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 4-[4-(4-methylphenyl)sulfanylanilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 5239702 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 4-[4-(4-methylphenyl)sulfanylanilino]-4-oxobutanoate |
| SMILES | Cc1ccc(Sc2ccc(NC(=O)CCC(=O)OCC(=O)c3cccc([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C25H22N2O6S/c1-17-5-9-21(10-6-17)34-22-11-7-19(8-12-22)26-24(29)13-14-25(30)33-16-23(28)18-3-2-4-20(15-18)27(31)32/h2-12,15H,13-14,16H2,1H3,(H,26,29) |
| InChIKey | HQWCJMNCRFFBKX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|