C30H28N2O9 — CID 19645364
[2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-ethylphenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate (PubChem CID 19645364) has the molecular formula C30H28N2O9 and a molecular weight of 560.56 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-ethylphenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-ethylphenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 19645364 |
| Molecular Formula | C30H28N2O9 |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-ethylphenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate |
| SMILES | CCc1ccc(C(=O)COC(=O)CCCC(=O)Nc2ccc(C(=O)OCC(=O)c3cccc([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O9/c1-2-20-9-11-21(12-10-20)26(33)18-40-29(36)8-4-7-28(35)31-24-15-13-22(14-16-24)30(37)41-19-27(34)23-5-3-6-25(17-23)32(38)39/h3,5-6,9-17H,2,4,7-8,18-19H2,1H3,(H,31,35) |
| InChIKey | MVVNINFTJDRUDI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 158.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|