C20H19NO7 — CID 2287436
[2-(3-nitrophenyl)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate (PubChem CID 2287436) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 2287436 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 4-(4-ethoxyphenyl)-4-oxobutanoate |
| SMILES | CCOc1ccc(C(=O)CCC(=O)OCC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H19NO7/c1-2-27-17-8-6-14(7-9-17)18(22)10-11-20(24)28-13-19(23)15-4-3-5-16(12-15)21(25)26/h3-9,12H,2,10-11,13H2,1H3 |
| InChIKey | XRZJUSLEPHZGER-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|