C23H21NO4S2 — CID 3577313
(2-oxo-2-thiophen-2-ylethyl) 5-oxo-5-(4-phenylsulfanylanilino)pentanoate (PubChem CID 3577313) has the molecular formula C23H21NO4S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 5-oxo-5-(4-phenylsulfanylanilino)pentanoate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 5-oxo-5-(4-phenylsulfanylanilino)pentanoate |
|---|---|
| PubChem CID | 3577313 |
| Molecular Formula | C23H21NO4S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 5-oxo-5-(4-phenylsulfanylanilino)pentanoate |
| SMILES | O=C(CCCC(=O)OCC(=O)c1cccs1)Nc1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO4S2/c25-20(21-8-5-15-29-21)16-28-23(27)10-4-9-22(26)24-17-11-13-19(14-12-17)30-18-6-2-1-3-7-18/h1-3,5-8,11-15H,4,9-10,16H2,(H,24,26) |
| InChIKey | FMPLMODCEBPJST-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |