C26H24FNO7S — CID 3827304
[2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 5-(4-fluoroanilino)-5-oxopentanoate (PubChem CID 3827304) has the molecular formula C26H24FNO7S and a molecular weight of 513.54 g/mol. Its IUPAC name is [2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 5-(4-fluoroanilino)-5-oxopentanoate.
| Compound Name | [2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 5-(4-fluoroanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 3827304 |
| Molecular Formula | C26H24FNO7S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | [2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 5-(4-fluoroanilino)-5-oxopentanoate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(=O)COC(=O)CCCC(=O)Nc3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H24FNO7S/c1-18-5-15-23(16-6-18)36(32,33)35-22-13-7-19(8-14-22)24(29)17-34-26(31)4-2-3-25(30)28-21-11-9-20(27)10-12-21/h5-16H,2-4,17H2,1H3,(H,28,30) |
| InChIKey | FEDGCAYKDNFEEZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|