C19H17Br2NO4 — CID 3446480
[2-(4-bromophenyl)-2-oxoethyl] 4-(4-bromo-2-methylanilino)-4-oxobutanoate (PubChem CID 3446480) has the molecular formula C19H17Br2NO4 and a molecular weight of 483.16 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 4-(4-bromo-2-methylanilino)-4-oxobutanoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 4-(4-bromo-2-methylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 3446480 |
| Molecular Formula | C19H17Br2NO4 |
| Molecular Weight | 483.16 g/mol |
| Exact Mass | 480.95 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 4-(4-bromo-2-methylanilino)-4-oxobutanoate |
| SMILES | Cc1cc(Br)ccc1NC(=O)CCC(=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17Br2NO4/c1-12-10-15(21)6-7-16(12)22-18(24)8-9-19(25)26-11-17(23)13-2-4-14(20)5-3-13/h2-7,10H,8-9,11H2,1H3,(H,22,24) |
| InChIKey | VVLVZMOVDWGNFZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |