C19H20BrNO3 — CID 78769298
3-(6-methyl-2-pyridinyl)propyl 4-(4-bromophenyl)-4-oxobutanoate (PubChem CID 78769298) has the molecular formula C19H20BrNO3 and a molecular weight of 390.28 g/mol. Its IUPAC name is 3-(6-methyl-2-pyridinyl)propyl 4-(4-bromophenyl)-4-oxobutanoate.
| Compound Name | 3-(6-methyl-2-pyridinyl)propyl 4-(4-bromophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 78769298 |
| Molecular Formula | C19H20BrNO3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 3-(6-methyl-2-pyridinyl)propyl 4-(4-bromophenyl)-4-oxobutanoate |
| SMILES | Cc1cccc(CCCOC(=O)CCC(=O)c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C19H20BrNO3/c1-14-4-2-5-17(21-14)6-3-13-24-19(23)12-11-18(22)15-7-9-16(20)10-8-15/h2,4-5,7-10H,3,6,11-13H2,1H3 |
| InChIKey | BPEOXUNYQDLLTO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|