C16H18N2O2S — CID 78838453
3-(6-methyl-2-pyridinyl)propyl 2-pyridin-4-ylsulfanylacetate (PubChem CID 78838453) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-(6-methyl-2-pyridinyl)propyl 2-pyridin-4-ylsulfanylacetate.
| Compound Name | 3-(6-methyl-2-pyridinyl)propyl 2-pyridin-4-ylsulfanylacetate |
|---|---|
| PubChem CID | 78838453 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-(6-methyl-2-pyridinyl)propyl 2-pyridin-4-ylsulfanylacetate |
| SMILES | Cc1cccc(CCCOC(=O)CSc2ccncc2)n1 |
| InChI | InChI=1S/C16H18N2O2S/c1-13-4-2-5-14(18-13)6-3-11-20-16(19)12-21-15-7-9-17-10-8-15/h2,4-5,7-10H,3,6,11-12H2,1H3 |
| InChIKey | PYRMYCNGRGSVBI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|