C24H28O2S — CID 67935190
3-(4-methylsulfinylphenyl)-1-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-2-en-1-one (PubChem CID 67935190) has the molecular formula C24H28O2S and a molecular weight of 380.55 g/mol. Its IUPAC name is 3-(4-methylsulfinylphenyl)-1-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-2-en-1-one.
| Compound Name | 3-(4-methylsulfinylphenyl)-1-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67935190 |
| Molecular Formula | C24H28O2S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 3-(4-methylsulfinylphenyl)-1-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-2-en-1-one |
| SMILES | CC1C(C)(C)c2ccc(C(=O)C=Cc3ccc(S(C)=O)cc3)cc2C1(C)C |
| InChI | InChI=1S/C24H28O2S/c1-16-23(2,3)20-13-10-18(15-21(20)24(16,4)5)22(25)14-9-17-7-11-19(12-8-17)27(6)26/h7-16H,1-6H3 |
| InChIKey | PMUCZNRZRBDXJZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|