C26H31N5O — CID 54407146
4-[2-(1,1,2,3,3,6-hexamethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 54407146) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is 4-[2-(1,1,2,3,3,6-hexamethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[2-(1,1,2,3,3,6-hexamethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 54407146 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 4-[2-(1,1,2,3,3,6-hexamethyl-2H-inden-5-yl)prop-1-enyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | CC(=Cc1ccc(C(=O)Nc2nn[nH]n2)cc1)c1cc2c(cc1C)C(C)(C)C(C)C2(C)C |
| InChI | InChI=1S/C26H31N5O/c1-15(12-18-8-10-19(11-9-18)23(32)27-24-28-30-31-29-24)20-14-22-21(13-16(20)2)25(4,5)17(3)26(22,6)7/h8-14,17H,1-7H3,(H2,27,28,29,30,31,32) |
| InChIKey | VRNHTLGHNJRHIN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|