C24H26N2O3 — CID 57197801
[3-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl]oxaziridin-3-yl] cyanate (PubChem CID 57197801) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is [3-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl]oxaziridin-3-yl] cyanate.
| Compound Name | [3-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl]oxaziridin-3-yl] cyanate |
|---|---|
| PubChem CID | 57197801 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [3-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl]oxaziridin-3-yl] cyanate |
| SMILES | Cc1cc2c(cc1C(=O)c1ccc(C3(OC#N)NO3)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H26N2O3/c1-15-12-19-20(23(4,5)11-10-22(19,2)3)13-18(15)21(27)16-6-8-17(9-7-16)24(26-29-24)28-14-25/h6-9,12-13,26H,10-11H2,1-5H3 |
| InChIKey | UNMWVPSNPHQOCE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|