C21H22O5 — CID 127024144
4-(7-ethoxy-4,4-dimethyl-2,3-dihydrochromene-6-carbonyl)benzoic acid (PubChem CID 127024144) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 4-(7-ethoxy-4,4-dimethyl-2,3-dihydrochromene-6-carbonyl)benzoic acid.
| Compound Name | 4-(7-ethoxy-4,4-dimethyl-2,3-dihydrochromene-6-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 127024144 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-(7-ethoxy-4,4-dimethyl-2,3-dihydrochromene-6-carbonyl)benzoic acid |
| SMILES | CCOc1cc2c(cc1C(=O)c1ccc(C(=O)O)cc1)C(C)(C)CCO2 |
| InChI | InChI=1S/C21H22O5/c1-4-25-17-12-18-16(21(2,3)9-10-26-18)11-15(17)19(22)13-5-7-14(8-6-13)20(23)24/h5-8,11-12H,4,9-10H2,1-3H3,(H,23,24) |
| InChIKey | NYAJIFUXDUYLRS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |