C23H26O4 — CID 70477211
3-methoxy-4-[(E)-2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)prop-1-enyl]benzoic acid (PubChem CID 70477211) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-methoxy-4-[(E)-2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)prop-1-enyl]benzoic acid.
| Compound Name | 3-methoxy-4-[(E)-2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 70477211 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-methoxy-4-[(E)-2-(4,4,7-trimethyl-2,3-dihydrochromen-6-yl)prop-1-enyl]benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1/C=C(\C)c1cc2c(cc1C)OCCC2(C)C |
| InChI | InChI=1S/C23H26O4/c1-14(10-16-6-7-17(22(24)25)12-20(16)26-5)18-13-19-21(11-15(18)2)27-9-8-23(19,3)4/h6-7,10-13H,8-9H2,1-5H3,(H,24,25)/b14-10+ |
| InChIKey | CMPWFFPHPZKASD-GXDHUFHOSA-N |
| XLogP | 5.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|