C25H29IO3 — CID 70186052
4-iodo-3-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enoxy]benzoic acid (PubChem CID 70186052) has the molecular formula C25H29IO3 and a molecular weight of 504.41 g/mol. Its IUPAC name is 4-iodo-3-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enoxy]benzoic acid.
| Compound Name | 4-iodo-3-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enoxy]benzoic acid |
|---|---|
| PubChem CID | 70186052 |
| Molecular Formula | C25H29IO3 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 4-iodo-3-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enoxy]benzoic acid |
| SMILES | C/C(=C\Oc1cc(C(=O)O)ccc1I)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H29IO3/c1-15-11-19-20(25(5,6)10-9-24(19,3)4)13-18(15)16(2)14-29-22-12-17(23(27)28)7-8-21(22)26/h7-8,11-14H,9-10H2,1-6H3,(H,27,28)/b16-14+ |
| InChIKey | MPZSPBPDMXWUTH-JQIJEIRASA-N |
| XLogP | 7.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|