C22H28N2O2 — CID 19002108
5-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]-1H-imidazole-2-carboxylic acid (PubChem CID 19002108) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 5-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]-1H-imidazole-2-carboxylic acid.
| Compound Name | 5-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]-1H-imidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 19002108 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 5-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]-1H-imidazole-2-carboxylic acid |
| SMILES | C/C(=C\c1cnc(C(=O)O)[nH]1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H28N2O2/c1-13(9-15-12-23-19(24-15)20(25)26)16-11-18-17(10-14(16)2)21(3,4)7-8-22(18,5)6/h9-12H,7-8H2,1-6H3,(H,23,24)(H,25,26)/b13-9+ |
| InChIKey | WUGPEOVXUGKINO-UKTHLTGXSA-N |
| XLogP | 5.33 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |