C24H31NO2 — CID 58641946
6-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]pyridine-3-carboxylic acid (PubChem CID 58641946) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 6-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 58641946 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 6-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]pyridine-3-carboxylic acid |
| SMILES | Cc1cc2c(cc1C(C)(C)c1ccc(C(=O)O)cn1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H31NO2/c1-15-12-18-19(23(4,5)11-10-22(18,2)3)13-17(15)24(6,7)20-9-8-16(14-25-20)21(26)27/h8-9,12-14H,10-11H2,1-7H3,(H,26,27) |
| InChIKey | NBYWUVRUVLKEJP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |