C25H31FO3 — CID 156689197
4-[3-fluoro-1-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)propyl]benzoic acid (PubChem CID 156689197) has the molecular formula C25H31FO3 and a molecular weight of 398.52 g/mol. Its IUPAC name is 4-[3-fluoro-1-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)propyl]benzoic acid.
| Compound Name | 4-[3-fluoro-1-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)propyl]benzoic acid |
|---|---|
| PubChem CID | 156689197 |
| Molecular Formula | C25H31FO3 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 4-[3-fluoro-1-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)propyl]benzoic acid |
| SMILES | Cc1cc2c(cc1C(O)(CCF)c1ccc(C(=O)O)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H31FO3/c1-16-14-20-21(24(4,5)11-10-23(20,2)3)15-19(16)25(29,12-13-26)18-8-6-17(7-9-18)22(27)28/h6-9,14-15,29H,10-13H2,1-5H3,(H,27,28) |
| InChIKey | MKYDGNTWPSVBRE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |