C25H26N2O3 — CID 10092518
cyanoiminomethyl 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)benzoate (PubChem CID 10092518) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is cyanoiminomethyl 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)benzoate.
| Compound Name | cyanoiminomethyl 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 10092518 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | cyanoiminomethyl 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)benzoate |
| SMILES | Cc1cc2c(cc1C(=O)c1ccc(C(=O)O/C=N/C#N)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H26N2O3/c1-16-12-20-21(25(4,5)11-10-24(20,2)3)13-19(16)22(28)17-6-8-18(9-7-17)23(29)30-15-27-14-26/h6-9,12-13,15H,10-11H2,1-5H3/b27-15+ |
| InChIKey | KWMXSGUGUOIWJP-JFLMPSFJSA-N |
| XLogP | 5.24 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|