C29H34O4 — CID 91334937
2,2-dimethyl-5-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]-1,3-dioxane-4,6-dione (PubChem CID 91334937) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2,2-dimethyl-5-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 91334937 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 2,2-dimethyl-5-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]-1,3-dioxane-4,6-dione |
| SMILES | C=C(c1ccc(C2C(=O)OC(C)(C)OC2=O)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H34O4/c1-17-15-22-23(28(5,6)14-13-27(22,3)4)16-21(17)18(2)19-9-11-20(12-10-19)24-25(30)32-29(7,8)33-26(24)31/h9-12,15-16,24H,2,13-14H2,1,3-8H3 |
| InChIKey | WESPKZLOIHGDDS-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|