C28H34N2O2 — CID 11464590
2-[4-[(E)-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclohexane-1,3-dione (PubChem CID 11464590) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-[4-[(E)-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclohexane-1,3-dione.
| Compound Name | 2-[4-[(E)-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 11464590 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 2-[4-[(E)-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclohexane-1,3-dione |
| SMILES | Cc1cc2c(cc1/C(=N/N)c1ccc(C3C(=O)CCCC3=O)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H34N2O2/c1-17-15-21-22(28(4,5)14-13-27(21,2)3)16-20(17)26(30-29)19-11-9-18(10-12-19)25-23(31)7-6-8-24(25)32/h9-12,15-16,25H,6-8,13-14,29H2,1-5H3/b30-26+ |
| InChIKey | LKJPQTKNMOUGIL-URGPHPNLSA-N |
| XLogP | 5.46 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|