C30H36O2 — CID 11407726
2-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]cyclohexane-1,3-dione (PubChem CID 11407726) has the molecular formula C30H36O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 2-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]cyclohexane-1,3-dione.
| Compound Name | 2-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 11407726 |
| Molecular Formula | C30H36O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 2-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]cyclohexane-1,3-dione |
| SMILES | Cc1cc2c(cc1C1(c3ccc(C4C(=O)CCCC4=O)cc3)CC1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H36O2/c1-19-17-23-24(29(4,5)14-13-28(23,2)3)18-22(19)30(15-16-30)21-11-9-20(10-12-21)27-25(31)7-6-8-26(27)32/h9-12,17-18,27H,6-8,13-16H2,1-5H3 |
| InChIKey | OTBAXFGVWMIATJ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|