C28H33NO2 — CID 11452746
2-[6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]-3-pyridinyl]cyclohexane-1,3-dione (PubChem CID 11452746) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 2-[6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]-3-pyridinyl]cyclohexane-1,3-dione.
| Compound Name | 2-[6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]-3-pyridinyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 11452746 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 2-[6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]-3-pyridinyl]cyclohexane-1,3-dione |
| SMILES | C=C(c1ccc(C2C(=O)CCCC2=O)cn1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H33NO2/c1-17-14-21-22(28(5,6)13-12-27(21,3)4)15-20(17)18(2)23-11-10-19(16-29-23)26-24(30)8-7-9-25(26)31/h10-11,14-16,26H,2,7-9,12-13H2,1,3-6H3 |
| InChIKey | KLNFUYBAGZSBNU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|