C31H43NO2 — CID 142982003
ethane;3-hydroxy-2-[6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]-3-pyridinyl]cyclopent-2-en-1-one (PubChem CID 142982003) has the molecular formula C31H43NO2 and a molecular weight of 461.69 g/mol. Its IUPAC name is ethane;3-hydroxy-2-[6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]-3-pyridinyl]cyclopent-2-en-1-one.
| Compound Name | ethane;3-hydroxy-2-[6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]-3-pyridinyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 142982003 |
| Molecular Formula | C31H43NO2 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | ethane;3-hydroxy-2-[6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]-3-pyridinyl]cyclopent-2-en-1-one |
| SMILES | C=C(c1ccc(C2=C(O)CCC2=O)cn1)c1cc2c(cc1C)C(C)(C)CCC2(C)C.CC.CC |
| InChI | InChI=1S/C27H31NO2.2C2H6/c1-16-13-20-21(27(5,6)12-11-26(20,3)4)14-19(16)17(2)22-8-7-18(15-28-22)25-23(29)9-10-24(25)30;2*1-2/h7-8,13-15,29H,2,9-12H2,1,3-6H3;2*1-2H3 |
| InChIKey | VSEQLRVQQZQODZ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |