C47H56O3 — CID 159113507
1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]-2,3-dihydronaphthalene;4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]benzoic acid (PubChem CID 159113507) has the molecular formula C47H56O3 and a molecular weight of 668.96 g/mol. Its IUPAC name is 1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]-2,3-dihydronaphthalene;4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]benzoic acid.
| Compound Name | 1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]-2,3-dihydronaphthalene;4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]benzoic acid |
|---|---|
| PubChem CID | 159113507 |
| Molecular Formula | C47H56O3 |
| Molecular Weight | 668.96 g/mol |
| Exact Mass | 668.42 |
| IUPAC Name | 1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]-2,3-dihydronaphthalene;4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]benzoic acid |
| SMILES | C=C(c1ccc(C)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C.CC1(C)CCC(C)(C)c2cc(CC(=O)c3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C24H30.C23H26O3/c1-16-8-10-19(11-9-16)18(3)20-15-22-21(14-17(20)2)23(4,5)12-13-24(22,6)7;1-22(2)11-12-23(3,4)19-13-15(5-10-18(19)22)14-20(24)16-6-8-17(9-7-16)21(25)26/h8-11,14-15H,3,12-13H2,1-2,4-7H3;5-10,13H,11-12,14H2,1-4H3,(H,25,26) |
| InChIKey | KEUGAJPGGCUGSL-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.96 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |