C32H37BO4 — CID 158183292
[4-[[2-oxo-2-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]ethoxy]methyl]phenyl]boronic acid (PubChem CID 158183292) has the molecular formula C32H37BO4 and a molecular weight of 496.46 g/mol. Its IUPAC name is [4-[[2-oxo-2-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]ethoxy]methyl]phenyl]boronic acid.
| Compound Name | [4-[[2-oxo-2-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]ethoxy]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 158183292 |
| Molecular Formula | C32H37BO4 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | [4-[[2-oxo-2-[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]ethoxy]methyl]phenyl]boronic acid |
| SMILES | C=C(c1ccc(C(=O)COCc2ccc(B(O)O)cc2)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C32H37BO4/c1-21-17-28-29(32(5,6)16-15-31(28,3)4)18-27(21)22(2)24-9-11-25(12-10-24)30(34)20-37-19-23-7-13-26(14-8-23)33(35)36/h7-14,17-18,35-36H,2,15-16,19-20H2,1,3-6H3 |
| InChIKey | FYVWCEQPZNAMGN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|