C72H52N6Si2 — CID 161126582
triphenyl-[3-[4-phenyl-6-[2-[4-phenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane (PubChem CID 161126582) has the molecular formula C72H52N6Si2 and a molecular weight of 1057.42 g/mol. Its IUPAC name is triphenyl-[3-[4-phenyl-6-[2-[4-phenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane.
| Compound Name | triphenyl-[3-[4-phenyl-6-[2-[4-phenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 161126582 |
| Molecular Formula | C72H52N6Si2 |
| Molecular Weight | 1057.42 g/mol |
| Exact Mass | 1056.38 |
| IUPAC Name | triphenyl-[3-[4-phenyl-6-[2-[4-phenyl-6-(3-triphenylsilylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane |
| SMILES | c1ccc(-c2nc(-c3cccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)c3)nc(-c3ccccc3-c3nc(-c4ccccc4)nc(-c4cccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)c4)n3)n2)cc1 |
| InChI | InChI=1S/C72H52N6Si2/c1-9-29-53(30-10-1)67-73-69(55-33-27-47-63(51-55)79(57-35-13-3-14-36-57,58-37-15-4-16-38-58)59-39-17-5-18-40-59)77-71(75-67)65-49-25-26-50-66(65)72-76-68(54-31-11-2-12-32-54)74-70(78-72)56-34-28-48-64(52-56)80(60-41-19-6-20-42-60,61-43-21-7-22-44-61)62-45-23-8-24-46-62/h1-52H |
| InChIKey | ZBWGELKMPJIWPF-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.42 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|