C59H41N3Si — CID 156690632
[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenanthren-9-ylphenyl]phenyl]-triphenylsilane (PubChem CID 156690632) has the molecular formula C59H41N3Si and a molecular weight of 820.08 g/mol. Its IUPAC name is [3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenanthren-9-ylphenyl]phenyl]-triphenylsilane.
| Compound Name | [3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenanthren-9-ylphenyl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 156690632 |
| Molecular Formula | C59H41N3Si |
| Molecular Weight | 820.08 g/mol |
| Exact Mass | 819.31 |
| IUPAC Name | [3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenanthren-9-ylphenyl]phenyl]-triphenylsilane |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4cccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)c4)c(-c4cc5ccccc5c5ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C59H41N3Si/c1-6-21-42(22-7-1)57-60-58(43-23-8-2-9-24-43)62-59(61-57)46-37-38-52(55(41-46)56-40-45-25-16-17-34-51(45)53-35-18-19-36-54(53)56)44-26-20-33-50(39-44)63(47-27-10-3-11-28-47,48-29-12-4-13-30-48)49-31-14-5-15-32-49/h1-41H |
| InChIKey | QCSCMTKLYVHPIX-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.08 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|