C59H44N2Si — CID 176640932
triphenyl-[3-[2-phenyl-6-(3-tritylphenyl)pyrimidin-4-yl]phenyl]silane (PubChem CID 176640932) has the molecular formula C59H44N2Si and a molecular weight of 809.10 g/mol. Its IUPAC name is triphenyl-[3-[2-phenyl-6-(3-tritylphenyl)pyrimidin-4-yl]phenyl]silane.
| Compound Name | triphenyl-[3-[2-phenyl-6-(3-tritylphenyl)pyrimidin-4-yl]phenyl]silane |
|---|---|
| PubChem CID | 176640932 |
| Molecular Formula | C59H44N2Si |
| Molecular Weight | 809.10 g/mol |
| Exact Mass | 808.33 |
| IUPAC Name | triphenyl-[3-[2-phenyl-6-(3-tritylphenyl)pyrimidin-4-yl]phenyl]silane |
| SMILES | c1ccc(-c2nc(-c3cccc(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3)cc(-c3cccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C59H44N2Si/c1-8-24-45(25-9-1)58-60-56(46-26-22-34-51(42-46)59(48-28-10-2-11-29-48,49-30-12-3-13-31-49)50-32-14-4-15-33-50)44-57(61-58)47-27-23-41-55(43-47)62(52-35-16-5-17-36-52,53-37-18-6-19-38-53)54-39-20-7-21-40-54/h1-44H |
| InChIKey | PEIQYMKVCSUCIZ-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.10 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|