C45H31N3SSi — CID 164757082
dibenzothiophen-3-yl-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-diphenylsilane (PubChem CID 164757082) has the molecular formula C45H31N3SSi and a molecular weight of 673.92 g/mol. Its IUPAC name is dibenzothiophen-3-yl-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-diphenylsilane.
| Compound Name | dibenzothiophen-3-yl-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-diphenylsilane |
|---|---|
| PubChem CID | 164757082 |
| Molecular Formula | C45H31N3SSi |
| Molecular Weight | 673.92 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | dibenzothiophen-3-yl-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-diphenylsilane |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc([Si](c4ccccc4)(c4ccccc4)c4ccc5c(c4)sc4ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C45H31N3SSi/c1-5-16-32(17-6-1)43-46-44(33-18-7-2-8-19-33)48-45(47-43)34-20-15-25-37(30-34)50(35-21-9-3-10-22-35,36-23-11-4-12-24-36)38-28-29-40-39-26-13-14-27-41(39)49-42(40)31-38/h1-31H |
| InChIKey | VFXOGBWCRXAAKD-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.92 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|