C46H35N3O2Si — CID 176645246
[4-[3-[3-[3-[4,6-bis(1-benzofuran-2-yl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane (PubChem CID 176645246) has the molecular formula C46H35N3O2Si and a molecular weight of 689.89 g/mol. Its IUPAC name is [4-[3-[3-[3-[4,6-bis(1-benzofuran-2-yl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[3-[3-[3-[4,6-bis(1-benzofuran-2-yl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 176645246 |
| Molecular Formula | C46H35N3O2Si |
| Molecular Weight | 689.89 g/mol |
| Exact Mass | 689.25 |
| IUPAC Name | [4-[3-[3-[3-[4,6-bis(1-benzofuran-2-yl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2cccc(-c3cccc(-c4cccc(-c5nc(-c6cc7ccccc7o6)nc(-c6cc7ccccc7o6)n5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C46H35N3O2Si/c1-52(2,3)39-23-21-30(22-24-39)31-13-8-14-32(25-31)33-15-9-16-34(26-33)35-17-10-18-38(27-35)44-47-45(42-28-36-11-4-6-19-40(36)50-42)49-46(48-44)43-29-37-12-5-7-20-41(37)51-43/h4-29H,1-3H3 |
| InChIKey | FNFQWGXFVZWZJT-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.89 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|