C17H14FNO5 — CID 118913443
2-(2-fluorophenyl)-6,7,8-trimethoxy-3,1-benzoxazin-4-one (PubChem CID 118913443) has the molecular formula C17H14FNO5 and a molecular weight of 331.30 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-6,7,8-trimethoxy-3,1-benzoxazin-4-one.
| Compound Name | 2-(2-fluorophenyl)-6,7,8-trimethoxy-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 118913443 |
| Molecular Formula | C17H14FNO5 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-(2-fluorophenyl)-6,7,8-trimethoxy-3,1-benzoxazin-4-one |
| SMILES | COc1cc2c(=O)oc(-c3ccccc3F)nc2c(OC)c1OC |
| InChI | InChI=1S/C17H14FNO5/c1-21-12-8-10-13(15(23-3)14(12)22-2)19-16(24-17(10)20)9-6-4-5-7-11(9)18/h4-8H,1-3H3 |
| InChIKey | MPUQPRRRSIUOEN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |