C19H12N4O — CID 56772317
2-naphthalen-1-yl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole (PubChem CID 56772317) has the molecular formula C19H12N4O and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-naphthalen-1-yl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole.
| Compound Name | 2-naphthalen-1-yl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 56772317 |
| Molecular Formula | C19H12N4O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-naphthalen-1-yl-6-(1,2,4-triazol-4-yl)-1,3-benzoxazole |
| SMILES | c1ccc2c(-c3nc4ccc(-n5cnnc5)cc4o3)cccc2c1 |
| InChI | InChI=1S/C19H12N4O/c1-2-6-15-13(4-1)5-3-7-16(15)19-22-17-9-8-14(10-18(17)24-19)23-11-20-21-12-23/h1-12H |
| InChIKey | RTVUZIJQRGDMIS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |