C23H14N2O5 — CID 10237626
2-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 10237626) has the molecular formula C23H14N2O5 and a molecular weight of 398.37 g/mol. Its IUPAC name is 2-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 10237626 |
| Molecular Formula | C23H14N2O5 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-[3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | Cc1ccc2nc(-c3cccc(N4C(=O)c5ccc(C(=O)O)cc5C4=O)c3)oc2c1 |
| InChI | InChI=1S/C23H14N2O5/c1-12-5-8-18-19(9-12)30-20(24-18)13-3-2-4-15(10-13)25-21(26)16-7-6-14(23(28)29)11-17(16)22(25)27/h2-11H,1H3,(H,28,29) |
| InChIKey | YLLULMDVGBEWNG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|